C15H18BNO6 — CID 131749729
2-hydroxy-3-(5-oxohexanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 131749729) has the molecular formula C15H18BNO6 and a molecular weight of 319.12 g/mol. Its IUPAC name is 2-hydroxy-3-(5-oxohexanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-3-(5-oxohexanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 131749729 |
| Molecular Formula | C15H18BNO6 |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-hydroxy-3-(5-oxohexanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(=O)CCCC(=O)NC1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C15H18BNO6/c1-9(18)4-2-7-13(19)17-12-8-10-5-3-6-11(15(20)21)14(10)23-16(12)22/h3,5-6,12,22H,2,4,7-8H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | HPQZNMZUMHDSSH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|