C16H21BN2O5 — CID 154053617
2-hydroxy-3-[(2-piperidin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 154053617) has the molecular formula C16H21BN2O5 and a molecular weight of 332.17 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-piperidin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-3-[(2-piperidin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 154053617 |
| Molecular Formula | C16H21BN2O5 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-hydroxy-3-[(2-piperidin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(CC1CCNCC1)NC1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C16H21BN2O5/c20-14(8-10-4-6-18-7-5-10)19-13-9-11-2-1-3-12(16(21)22)15(11)24-17(13)23/h1-3,10,13,18,23H,4-9H2,(H,19,20)(H,21,22) |
| InChIKey | JWDJQRVLSYDYNT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|