C15H19BN2O5 — CID 86269573
(3R)-2-hydroxy-3-(piperidine-4-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 86269573) has the molecular formula C15H19BN2O5 and a molecular weight of 318.14 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-(piperidine-4-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-(piperidine-4-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 86269573 |
| Molecular Formula | C15H19BN2O5 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (3R)-2-hydroxy-3-(piperidine-4-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)[C@@H](NC(=O)C1CCNCC1)C2 |
| InChI | InChI=1S/C15H19BN2O5/c19-14(9-4-6-17-7-5-9)18-12-8-10-2-1-3-11(15(20)21)13(10)23-16(12)22/h1-3,9,12,17,22H,4-8H2,(H,18,19)(H,20,21)/t12-/m0/s1 |
| InChIKey | HHFQXQJCTRXOTI-LBPRGKRZSA-N |
| XLogP | -0.18 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|