C17H22BNO5 — CID 153070693
(3R)-2-hydroxy-3-(2-oxo-3-piperidin-4-ylpropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 153070693) has the molecular formula C17H22BNO5 and a molecular weight of 331.18 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-(2-oxo-3-piperidin-4-ylpropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-(2-oxo-3-piperidin-4-ylpropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 153070693 |
| Molecular Formula | C17H22BNO5 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3R)-2-hydroxy-3-(2-oxo-3-piperidin-4-ylpropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(CC1CCNCC1)C[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C17H22BNO5/c20-14(8-11-4-6-19-7-5-11)10-13-9-12-2-1-3-15(17(21)22)16(12)24-18(13)23/h1-3,11,13,19,23H,4-10H2,(H,21,22)/t13-/m1/s1 |
| InChIKey | VLHGIAKXVKQFOS-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|