C19H25BN2O5 — CID 149349449
(3R)-3-[3-[4-(aminomethylideneamino)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 149349449) has the molecular formula C19H25BN2O5 and a molecular weight of 372.23 g/mol. Its IUPAC name is (3R)-3-[3-[4-(aminomethylideneamino)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[3-[4-(aminomethylideneamino)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 149349449 |
| Molecular Formula | C19H25BN2O5 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (3R)-3-[3-[4-(aminomethylideneamino)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | N/C=N/C1CCC(CC(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)CC1 |
| InChI | InChI=1S/C19H25BN2O5/c21-11-22-15-6-4-12(5-7-15)8-16(23)10-14-9-13-2-1-3-17(19(24)25)18(13)27-20(14)26/h1-3,11-12,14-15,26H,4-10H2,(H2,21,22)(H,24,25)/t12?,14-,15?/m1/s1 |
| InChIKey | YFSOBIKHIDYOCE-HNFVBEJKSA-N |
| XLogP | 2.07 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|