C14H17BN2O6 — CID 140739648
(3R)-3-(3-acetamidopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 140739648) has the molecular formula C14H17BN2O6 and a molecular weight of 320.11 g/mol. Its IUPAC name is (3R)-3-(3-acetamidopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(3-acetamidopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 140739648 |
| Molecular Formula | C14H17BN2O6 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (3R)-3-(3-acetamidopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(=O)NCCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C14H17BN2O6/c1-8(18)16-6-5-12(19)17-11-7-9-3-2-4-10(14(20)21)13(9)23-15(11)22/h2-4,11,22H,5-7H2,1H3,(H,16,18)(H,17,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | LMXBEQBBJQAKSD-NSHDSACASA-N |
| XLogP | -0.65 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|