C19H29BN4O5 — CID 144718757
(3R)-3-[[2-[4-[2-(ethylamino)ethyl]piperazin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 144718757) has the molecular formula C19H29BN4O5 and a molecular weight of 404.28 g/mol. Its IUPAC name is (3R)-3-[[2-[4-[2-(ethylamino)ethyl]piperazin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-[4-[2-(ethylamino)ethyl]piperazin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 144718757 |
| Molecular Formula | C19H29BN4O5 |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (3R)-3-[[2-[4-[2-(ethylamino)ethyl]piperazin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCNCCN1CCN(CC(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)CC1 |
| InChI | InChI=1S/C19H29BN4O5/c1-2-21-6-7-23-8-10-24(11-9-23)13-17(25)22-16-12-14-4-3-5-15(19(26)27)18(14)29-20(16)28/h3-5,16,21,28H,2,6-13H2,1H3,(H,22,25)(H,26,27)/t16-/m0/s1 |
| InChIKey | CPQAYDOFHWPELT-INIZCTEOSA-N |
| XLogP | -0.95 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|