C20H31BN4O5 — CID 144718732
(3R)-3-[[2-[4-[2-(ethylamino)ethylamino]piperidin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 144718732) has the molecular formula C20H31BN4O5 and a molecular weight of 418.30 g/mol. Its IUPAC name is (3R)-3-[[2-[4-[2-(ethylamino)ethylamino]piperidin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-[4-[2-(ethylamino)ethylamino]piperidin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 144718732 |
| Molecular Formula | C20H31BN4O5 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (3R)-3-[[2-[4-[2-(ethylamino)ethylamino]piperidin-1-yl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCNCCNC1CCN(CC(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)CC1 |
| InChI | InChI=1S/C20H31BN4O5/c1-2-22-8-9-23-15-6-10-25(11-7-15)13-18(26)24-17-12-14-4-3-5-16(20(27)28)19(14)30-21(17)29/h3-5,15,17,22-23,29H,2,6-13H2,1H3,(H,24,26)(H,27,28)/t17-/m0/s1 |
| InChIKey | CFZMMTAOCXACIW-KRWDZBQOSA-N |
| XLogP | -0.51 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|