C19H27BN4O6 — CID 123300260
2-hydroxy-3-[[2-[4-[2-(methylamino)ethylamino]-2-oxopiperidin-1-yl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 123300260) has the molecular formula C19H27BN4O6 and a molecular weight of 418.26 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-[4-[2-(methylamino)ethylamino]-2-oxopiperidin-1-yl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-3-[[2-[4-[2-(methylamino)ethylamino]-2-oxopiperidin-1-yl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 123300260 |
| Molecular Formula | C19H27BN4O6 |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-hydroxy-3-[[2-[4-[2-(methylamino)ethylamino]-2-oxopiperidin-1-yl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CNCCNC1CCN(CC(=O)NC2Cc3cccc(C(=O)O)c3OB2O)C(=O)C1 |
| InChI | InChI=1S/C19H27BN4O6/c1-21-6-7-22-13-5-8-24(17(26)10-13)11-16(25)23-15-9-12-3-2-4-14(19(27)28)18(12)30-20(15)29/h2-4,13,15,21-22,29H,5-11H2,1H3,(H,23,25)(H,27,28) |
| InChIKey | FIWLOIKZQLEITG-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|