C15H19BN2O6 — CID 131749658
(3R)-2-hydroxy-3-(4-methoxyiminopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 131749658) has the molecular formula C15H19BN2O6 and a molecular weight of 334.14 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-(4-methoxyiminopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-(4-methoxyiminopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 131749658 |
| Molecular Formula | C15H19BN2O6 |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (3R)-2-hydroxy-3-(4-methoxyiminopentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CON=C(C)CCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C15H19BN2O6/c1-9(18-23-2)6-7-13(19)17-12-8-10-4-3-5-11(15(20)21)14(10)24-16(12)22/h3-5,12,22H,6-8H2,1-2H3,(H,17,19)(H,20,21)/t12-/m0/s1 |
| InChIKey | RWLVBTCESPWIRR-LBPRGKRZSA-N |
| XLogP | 0.63 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|