C21H32BN3O5 — CID 123338417
2-hydroxy-3-[[2-[3-[[2-(methylamino)ethylamino]methyl]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 123338417) has the molecular formula C21H32BN3O5 and a molecular weight of 417.32 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-[3-[[2-(methylamino)ethylamino]methyl]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-3-[[2-[3-[[2-(methylamino)ethylamino]methyl]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 123338417 |
| Molecular Formula | C21H32BN3O5 |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-hydroxy-3-[[2-[3-[[2-(methylamino)ethylamino]methyl]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CNCCNCC1CCCC(CC(=O)NC2Cc3cccc(C(=O)O)c3OB2O)C1 |
| InChI | InChI=1S/C21H32BN3O5/c1-23-8-9-24-13-15-5-2-4-14(10-15)11-19(26)25-18-12-16-6-3-7-17(21(27)28)20(16)30-22(18)29/h3,6-7,14-15,18,23-24,29H,2,4-5,8-13H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | AOOYWWNFYVDYPT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|