C18H24BNO5 — CID 123558458
3-(2-cyclohexylpropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 123558458) has the molecular formula C18H24BNO5 and a molecular weight of 345.20 g/mol. Its IUPAC name is 3-(2-cyclohexylpropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 3-(2-cyclohexylpropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 123558458 |
| Molecular Formula | C18H24BNO5 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-(2-cyclohexylpropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(C(=O)NC1Cc2cccc(C(=O)O)c2OB1O)C1CCCCC1 |
| InChI | InChI=1S/C18H24BNO5/c1-11(12-6-3-2-4-7-12)17(21)20-15-10-13-8-5-9-14(18(22)23)16(13)25-19(15)24/h5,8-9,11-12,15,24H,2-4,6-7,10H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | ZWOSGCPFOIJZLT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|