C17H18BN2O8P — CID 166142724
(3R)-3-[[2-amino-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 166142724) has the molecular formula C17H18BN2O8P and a molecular weight of 420.12 g/mol. Its IUPAC name is (3R)-3-[[2-amino-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-amino-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 166142724 |
| Molecular Formula | C17H18BN2O8P |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (3R)-3-[[2-amino-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NC(C(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O)c1ccc(P(=O)(O)O)cc1 |
| InChI | InChI=1S/C17H18BN2O8P/c19-14(9-4-6-11(7-5-9)29(25,26)27)16(21)20-13-8-10-2-1-3-12(17(22)23)15(10)28-18(13)24/h1-7,13-14,24H,8,19H2,(H,20,21)(H,22,23)(H2,25,26,27)/t13-,14?/m0/s1 |
| InChIKey | IIBKMHVAOYRFDT-LSLKUGRBSA-N |
| XLogP | -0.67 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|