C23H25BN3O10P — CID 174228328
(3R)-2-hydroxy-3-[[2-[(2-oxopiperidine-1-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 174228328) has the molecular formula C23H25BN3O10P and a molecular weight of 545.25 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[[2-[(2-oxopiperidine-1-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[[2-[(2-oxopiperidine-1-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 174228328 |
| Molecular Formula | C23H25BN3O10P |
| Molecular Weight | 545.25 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | (3R)-2-hydroxy-3-[[2-[(2-oxopiperidine-1-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)[C@@H](NC(=O)C(NC(=O)N1CCCCC1=O)c1ccc(P(=O)(O)O)cc1)C2 |
| InChI | InChI=1S/C23H25BN3O10P/c28-18-6-1-2-11-27(18)23(32)26-19(13-7-9-15(10-8-13)38(34,35)36)21(29)25-17-12-14-4-3-5-16(22(30)31)20(14)37-24(17)33/h3-5,7-10,17,19,33H,1-2,6,11-12H2,(H,25,29)(H,26,32)(H,30,31)(H2,34,35,36)/t17-,19?/m0/s1 |
| InChIKey | QYHKILACNLPNMW-KKFHFHRHSA-N |
| XLogP | 0.09 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|