C23H21BN3O10P — CID 174228471
(3R)-2-hydroxy-3-[[2-[(4-oxo-1H-pyridine-3-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 174228471) has the molecular formula C23H21BN3O10P and a molecular weight of 541.22 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[[2-[(4-oxo-1H-pyridine-3-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[[2-[(4-oxo-1H-pyridine-3-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 174228471 |
| Molecular Formula | C23H21BN3O10P |
| Molecular Weight | 541.22 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | (3R)-2-hydroxy-3-[[2-[(4-oxo-1H-pyridine-3-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)[C@@H](NC(=O)C(NC(=O)c1c[nH]ccc1=O)c1ccc(P(=O)(O)O)cc1)C2 |
| InChI | InChI=1S/C23H21BN3O10P/c28-17-8-9-25-11-16(17)21(29)27-19(12-4-6-14(7-5-12)38(34,35)36)22(30)26-18-10-13-2-1-3-15(23(31)32)20(13)37-24(18)33/h1-9,11,18-19,33H,10H2,(H,25,28)(H,26,30)(H,27,29)(H,31,32)(H2,34,35,36)/t18-,19?/m0/s1 |
| InChIKey | PTIZVUZKNQNNJP-OYKVQYDMSA-N |
| XLogP | -0.51 |
| TPSA | 215.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|