C22H20BN4O10P — CID 174228307
(3R)-2-hydroxy-3-[[2-[(6-oxo-1H-pyridazine-5-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 174228307) has the molecular formula C22H20BN4O10P and a molecular weight of 542.21 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[[2-[(6-oxo-1H-pyridazine-5-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[[2-[(6-oxo-1H-pyridazine-5-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 174228307 |
| Molecular Formula | C22H20BN4O10P |
| Molecular Weight | 542.21 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | (3R)-2-hydroxy-3-[[2-[(6-oxo-1H-pyridazine-5-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)[C@@H](NC(=O)C(NC(=O)c1ccn[nH]c1=O)c1ccc(P(=O)(O)O)cc1)C2 |
| InChI | InChI=1S/C22H20BN4O10P/c28-19(15-8-9-24-27-20(15)29)26-17(11-4-6-13(7-5-11)38(34,35)36)21(30)25-16-10-12-2-1-3-14(22(31)32)18(12)37-23(16)33/h1-9,16-17,33H,10H2,(H,25,30)(H,26,28)(H,27,29)(H,31,32)(H2,34,35,36)/t16-,17?/m0/s1 |
| InChIKey | SRCKTIUTNGYYTB-BHWOMJMDSA-N |
| XLogP | -1.12 |
| TPSA | 228.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|