C21H20BN4O9PS — CID 174228362
3-[[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 174228362) has the molecular formula C21H20BN4O9PS and a molecular weight of 546.26 g/mol. Its IUPAC name is 3-[[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 3-[[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 174228362 |
| Molecular Formula | C21H20BN4O9PS |
| Molecular Weight | 546.26 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 3-[[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1nc(C(=O)NC(C(=O)NC2Cc3cccc(C(=O)O)c3OB2O)c2ccc(P(=O)(O)O)cc2)cs1 |
| InChI | InChI=1S/C21H20BN4O9PS/c23-21-24-14(9-37-21)18(27)26-16(10-4-6-12(7-5-10)36(32,33)34)19(28)25-15-8-11-2-1-3-13(20(29)30)17(11)35-22(15)31/h1-7,9,15-16,31H,8H2,(H2,23,24)(H,25,28)(H,26,27)(H,29,30)(H2,32,33,34) |
| InChIKey | AXHCZIAUPPWUOO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 221.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|