C19H18BNO6 — CID 146757206
(3R)-3-(2,5-dioxo-5-pyridin-3-ylpentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 146757206) has the molecular formula C19H18BNO6 and a molecular weight of 367.17 g/mol. Its IUPAC name is (3R)-3-(2,5-dioxo-5-pyridin-3-ylpentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(2,5-dioxo-5-pyridin-3-ylpentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 146757206 |
| Molecular Formula | C19H18BNO6 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (3R)-3-(2,5-dioxo-5-pyridin-3-ylpentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(CCC(=O)c1cccnc1)C[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C19H18BNO6/c22-15(6-7-17(23)13-4-2-8-21-11-13)10-14-9-12-3-1-5-16(19(24)25)18(12)27-20(14)26/h1-5,8,11,14,26H,6-7,9-10H2,(H,24,25)/t14-/m1/s1 |
| InChIKey | ROPVXSRMMZHGHO-CQSZACIVSA-N |
| XLogP | 2.19 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|