C19H22BN5O7S — CID 142485320
(3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142485320) has the molecular formula C19H22BN5O7S and a molecular weight of 475.29 g/mol. Its IUPAC name is (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142485320 |
| Molecular Formula | C19H22BN5O7S |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CNC(=O)C(C)(C)O/N=C(\C(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O)c1csc(N)n1 |
| InChI | InChI=1S/C19H22BN5O7S/c1-19(2,17(29)22-3)32-25-13(11-8-33-18(21)23-11)15(26)24-12-7-9-5-4-6-10(16(27)28)14(9)31-20(12)30/h4-6,8,12,30H,7H2,1-3H3,(H2,21,23)(H,22,29)(H,24,26)(H,27,28)/b25-13-/t12-/m0/s1 |
| InChIKey | HUGHKJYINTXNAA-XWSIGQBASA-N |
| XLogP | -0.19 |
| TPSA | 185.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|