C18H23BN6O4S — CID 142485327
(2Z)-N-[(3R)-8-amino-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(2-amino-1,3-thiazol-4-yl)-2-piperidin-4-yloxyiminoacetamide (PubChem CID 142485327) has the molecular formula C18H23BN6O4S and a molecular weight of 430.30 g/mol. Its IUPAC name is (2Z)-N-[(3R)-8-amino-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(2-amino-1,3-thiazol-4-yl)-2-piperidin-4-yloxyiminoacetamide.
| Compound Name | (2Z)-N-[(3R)-8-amino-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(2-amino-1,3-thiazol-4-yl)-2-piperidin-4-yloxyiminoacetamide |
|---|---|
| PubChem CID | 142485327 |
| Molecular Formula | C18H23BN6O4S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (2Z)-N-[(3R)-8-amino-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(2-amino-1,3-thiazol-4-yl)-2-piperidin-4-yloxyiminoacetamide |
| SMILES | Nc1nc(/C(=N/OC2CCNCC2)C(=O)N[C@H]2Cc3cccc(N)c3OB2O)cs1 |
| InChI | InChI=1S/C18H23BN6O4S/c20-12-3-1-2-10-8-14(19(27)28-16(10)12)24-17(26)15(13-9-30-18(21)23-13)25-29-11-4-6-22-7-5-11/h1-3,9,11,14,22,27H,4-8,20H2,(H2,21,23)(H,24,26)/b25-15-/t14-/m0/s1 |
| InChIKey | OAGRRIQYUDBFET-XWEJKRGESA-N |
| XLogP | -0.08 |
| TPSA | 157.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|