C24H32BN5O7S — CID 142485156
3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(cyclohexylamino)-2-oxoethoxy]iminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid;ethane (PubChem CID 142485156) has the molecular formula C24H32BN5O7S and a molecular weight of 545.43 g/mol. Its IUPAC name is 3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(cyclohexylamino)-2-oxoethoxy]iminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid;ethane.
| Compound Name | 3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(cyclohexylamino)-2-oxoethoxy]iminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142485156 |
| Molecular Formula | C24H32BN5O7S |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-(cyclohexylamino)-2-oxoethoxy]iminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid;ethane |
| SMILES | CC.Nc1nc(/C(=N/OCC(=O)NC2CCCCC2)C(=O)NC2Cc3cccc(C(=O)O)c3OB2O)cs1 |
| InChI | InChI=1S/C22H26BN5O7S.C2H6/c24-22-26-15(11-36-22)18(28-34-10-17(29)25-13-6-2-1-3-7-13)20(30)27-16-9-12-5-4-8-14(21(31)32)19(12)35-23(16)33;1-2/h4-5,8,11,13,16,33H,1-3,6-7,9-10H2,(H2,24,26)(H,25,29)(H,27,30)(H,31,32);1-2H3/b28-18-; |
| InChIKey | JEQVDMRIGGSYNG-OCEUWNEJSA-N |
| XLogP | 1.76 |
| TPSA | 185.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|