About 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol
2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol (PubChem CID 145366322) has the molecular formula C6H8N2O3S
and a molecular weight of 188.21 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol |
| PubChem CID | 145366322 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol |
| SMILES | CO.Nc1nc(C(=O)C=O)cs1 |
| InChI | InChI=1S/C5H4N2O2S.CH4O/c6-5-7-3(2-10-5)4(9)1-8;1-2/h1-2H,(H2,6,7);2H,1H3 |
| InChIKey | DERNVSCKCXABSM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol?
The IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol (CID 145366322) is 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol?
The canonical SMILES for 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol is CO.Nc1nc(C(=O)C=O)cs1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol?
The InChIKey is DERNVSCKCXABSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2S.CH4O/c6-5-7-3(2-10-5)4(9)1-8;1-2/h1-2H,(H2,6,7);2H,1H3.
What are the key properties of 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol?
2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol has a molecular weight of 188.21 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetaldehyde;methanol is sourced from PubChem (CID 145366322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).