C9H11N3O3S — CID 173341288
[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] butanoate (PubChem CID 173341288) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is [(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] butanoate.
| Compound Name | [(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] butanoate |
|---|---|
| PubChem CID | 173341288 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | [(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] butanoate |
| SMILES | CCCC(=O)O/N=C(\C=O)c1csc(N)n1 |
| InChI | InChI=1S/C9H11N3O3S/c1-2-3-8(14)15-12-6(4-13)7-5-16-9(10)11-7/h4-5H,2-3H2,1H3,(H2,10,11)/b12-6+ |
| InChIKey | UMWVVVWGEBPIBT-WUXMJOGZSA-N |
| XLogP | 0.97 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|