C7H10N4S — CID 146205733
(1Z,3Z)-1-(2-amino-1,3-thiazol-4-yl)buta-1,3-diene-1,4-diamine (PubChem CID 146205733) has the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. Its IUPAC name is (1Z,3Z)-1-(2-amino-1,3-thiazol-4-yl)buta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-(2-amino-1,3-thiazol-4-yl)buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 146205733 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1Z,3Z)-1-(2-amino-1,3-thiazol-4-yl)buta-1,3-diene-1,4-diamine |
| SMILES | N/C=C\C=C(/N)c1csc(N)n1 |
| InChI | InChI=1S/C7H10N4S/c8-3-1-2-5(9)6-4-12-7(10)11-6/h1-4H,8-9H2,(H2,10,11)/b3-1-,5-2- |
| InChIKey | SITFMJYRFHHLEH-LEWNYYKSSA-N |
| XLogP | 0.50 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|