C5H8N4S — CID 163485761
4-(2-aminoethanimidoyl)-1,3-thiazol-2-amine (PubChem CID 163485761) has the molecular formula C5H8N4S and a molecular weight of 156.21 g/mol. Its IUPAC name is 4-(2-aminoethanimidoyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-aminoethanimidoyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 163485761 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4-(2-aminoethanimidoyl)-1,3-thiazol-2-amine |
| SMILES | [H]/N=C(\CN)c1csc(N)n1 |
| InChI | InChI=1S/C5H8N4S/c6-1-3(7)4-2-10-5(8)9-4/h2,7H,1,6H2,(H2,8,9)/b7-3+ |
| InChIKey | CIJSWLARVDUOLH-XVNBXDOJSA-N |
| XLogP | 0.05 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|