C7H11N3O3S — CID 143798534
formic acid;4-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-thiazol-2-amine (PubChem CID 143798534) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is formic acid;4-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-thiazol-2-amine.
| Compound Name | formic acid;4-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143798534 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | formic acid;4-[(Z)-N-methoxy-C-methylcarbonimidoyl]-1,3-thiazol-2-amine |
| SMILES | CO/N=C(/C)c1csc(N)n1.O=CO |
| InChI | InChI=1S/C6H9N3OS.CH2O2/c1-4(9-10-2)5-3-11-6(7)8-5;2-1-3/h3H,1-2H3,(H2,7,8);1H,(H,2,3)/b9-4-; |
| InChIKey | IROFMTOVHFMDQS-WONROIIJSA-N |
| XLogP | 0.80 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|