C12H15N3O3S — CID 54475214
N-[4-(N-cyclohexyloxy-C-formylcarbonimidoyl)-1,3-thiazol-2-yl]formamide (PubChem CID 54475214) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[4-(N-cyclohexyloxy-C-formylcarbonimidoyl)-1,3-thiazol-2-yl]formamide.
| Compound Name | N-[4-(N-cyclohexyloxy-C-formylcarbonimidoyl)-1,3-thiazol-2-yl]formamide |
|---|---|
| PubChem CID | 54475214 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[4-(N-cyclohexyloxy-C-formylcarbonimidoyl)-1,3-thiazol-2-yl]formamide |
| SMILES | O=CNc1nc(C(C=O)=NOC2CCCCC2)cs1 |
| InChI | InChI=1S/C12H15N3O3S/c16-6-10(11-7-19-12(14-11)13-8-17)15-18-9-4-2-1-3-5-9/h6-9H,1-5H2,(H,13,14,17) |
| InChIKey | VJGZLBIHOYINSB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|