C17H17N5O6S3 — CID 88502814
(6R,7R)-7-[[(2Z)-2-cyclopropyloxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88502814) has the molecular formula C17H17N5O6S3 and a molecular weight of 483.55 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-cyclopropyloxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-cyclopropyloxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88502814 |
| Molecular Formula | C17H17N5O6S3 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-cyclopropyloxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CSC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N\OC3CC3)c3csc(NC=O)n3)[C@H]2SC1 |
| InChI | InChI=1S/C17H17N5O6S3/c1-29-9-5-30-15-11(14(25)22(15)12(9)16(26)27)20-13(24)10(21-28-7-2-3-7)8-4-31-17(19-8)18-6-23/h4,6-7,11,15H,2-3,5H2,1H3,(H,20,24)(H,26,27)(H,18,19,23)/b21-10-/t11-,15-/m1/s1 |
| InChIKey | UCRXURPMGJNIRX-QVJRADPESA-N |
| XLogP | 0.65 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|