C16H14ClN5O6S2 — CID 56620023
(6S)-3-(2-chloroethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56620023) has the molecular formula C16H14ClN5O6S2 and a molecular weight of 471.90 g/mol. Its IUPAC name is (6S)-3-(2-chloroethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-(2-chloroethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56620023 |
| Molecular Formula | C16H14ClN5O6S2 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | (6S)-3-(2-chloroethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C=CCl)CS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C16H14ClN5O6S2/c1-28-21-9(8-5-30-16(19-8)18-6-23)12(24)20-10-13(25)22-11(15(26)27)7(2-3-17)4-29-14(10)22/h2-3,5-6,10,14H,4H2,1H3,(H,20,24)(H,26,27)(H,18,19,23)/t10?,14-/m0/s1 |
| InChIKey | HZBMUJASMIOIPU-SBNLOKMTSA-N |
| XLogP | 0.55 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|