C23H22N6O6S3 — CID 57066798
(6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylethenylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57066798) has the molecular formula C23H22N6O6S3 and a molecular weight of 574.67 g/mol. Its IUPAC name is (6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylethenylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylethenylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57066798 |
| Molecular Formula | C23H22N6O6S3 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | (6S)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylethenylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(SC=Cc3cccnc3)CS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C23H22N6O6S3/c1-2-7-35-28-16(14-10-38-23(26-14)25-12-30)19(31)27-17-20(32)29-18(22(33)34)15(11-37-21(17)29)36-8-5-13-4-3-6-24-9-13/h3-6,8-10,12,17,21H,2,7,11H2,1H3,(H,27,31)(H,33,34)(H,25,26,30)/t17?,21-/m0/s1 |
| InChIKey | BNYIBQHCUSYVBM-LFABVHOISA-N |
| XLogP | 2.34 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|