C9H15N3OS — CID 62787415
2-amino-N-(2-methylbutyl)-1,3-thiazole-4-carboxamide (PubChem CID 62787415) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-amino-N-(2-methylbutyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(2-methylbutyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62787415 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-amino-N-(2-methylbutyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)CNC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C9H15N3OS/c1-3-6(2)4-11-8(13)7-5-14-9(10)12-7/h5-6H,3-4H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | PTGWZGQOFATITN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |