C10H17N3OS — CID 62789071
2-amino-N-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 62789071) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-amino-N-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62789071 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-amino-N-methyl-N-pentan-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCC(CC)N(C)C(=O)c1csc(N)n1 |
| InChI | InChI=1S/C10H17N3OS/c1-4-7(5-2)13(3)9(14)8-6-15-10(11)12-8/h6-7H,4-5H2,1-3H3,(H2,11,12) |
| InChIKey | COWCAUKGDPYVKN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |