About methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate
methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate (PubChem CID 62787060) has the molecular formula C8H11N3O3S
and a molecular weight of 229.26 g/mol. Its IUPAC name is methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate.
Analyze methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate?
The IUPAC name of methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate (CID 62787060) is methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate.
What is the SMILES notation for methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate?
The canonical SMILES for methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate is COC(=O)CCNC(=O)c1csc(N)n1.
What is the InChIKey of methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate?
The InChIKey is IPHUFFCMZYBWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3S/c1-14-6(12)2-3-10-7(13)5-4-15-8(9)11-5/h4H,2-3H2,1H3,(H2,9,11)(H,10,13).
What are the key properties of methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate?
methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate has a molecular weight of 229.26 g/mol, XLogP of 0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]propanoate is sourced from PubChem (CID 62787060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).