C8H11N3O4S — CID 79457217
2-[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]ethoxy]acetic acid (PubChem CID 79457217) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457217 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-[2-[(2-amino-1,3-thiazole-4-carbonyl)amino]ethoxy]acetic acid |
| SMILES | Nc1nc(C(=O)NCCOCC(=O)O)cs1 |
| InChI | InChI=1S/C8H11N3O4S/c9-8-11-5(4-16-8)7(14)10-1-2-15-3-6(12)13/h4H,1-3H2,(H2,9,11)(H,10,14)(H,12,13) |
| InChIKey | YYHFDVAXUFOZIL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|