C7H12N4O3S2 — CID 62788374
2-amino-N-[2-(methanesulfonamido)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 62788374) has the molecular formula C7H12N4O3S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-amino-N-[2-(methanesulfonamido)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-[2-(methanesulfonamido)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62788374 |
| Molecular Formula | C7H12N4O3S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-amino-N-[2-(methanesulfonamido)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C7H12N4O3S2/c1-16(13,14)10-3-2-9-6(12)5-4-15-7(8)11-5/h4,10H,2-3H2,1H3,(H2,8,11)(H,9,12) |
| InChIKey | LYDIVDLZRBDWMM-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|