C16H17N3O4S — CID 15053516
2-methylpropyl 2-oxo-2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 15053516) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-methylpropyl 2-oxo-2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-methylpropyl 2-oxo-2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 15053516 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-methylpropyl 2-oxo-2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CC(C)COC(=O)C(=O)c1csc(NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H17N3O4S/c1-10(2)8-23-14(21)13(20)12-9-24-16(18-12)19-15(22)17-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H2,17,18,19,22) |
| InChIKey | ZCOPUTKJUYLPMU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|