C16H17N3O4S — CID 15053505
ethyl 2-[2-[(2,6-dimethylphenyl)carbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate (PubChem CID 15053505) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is ethyl 2-[2-[(2,6-dimethylphenyl)carbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-[(2,6-dimethylphenyl)carbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 15053505 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | ethyl 2-[2-[(2,6-dimethylphenyl)carbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1csc(NC(=O)Nc2c(C)cccc2C)n1 |
| InChI | InChI=1S/C16H17N3O4S/c1-4-23-14(21)13(20)11-8-24-16(17-11)19-15(22)18-12-9(2)6-5-7-10(12)3/h5-8H,4H2,1-3H3,(H2,17,18,19,22) |
| InChIKey | GOXJAPYRRIAXGU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|