C10H12N2O5S2 — CID 138673871
ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-oxoacetate (PubChem CID 138673871) has the molecular formula C10H12N2O5S2 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 138673871 |
| Molecular Formula | C10H12N2O5S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1csc(NS(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C10H12N2O5S2/c1-2-17-9(14)8(13)7-5-18-10(11-7)12-19(15,16)6-3-4-6/h5-6H,2-4H2,1H3,(H,11,12) |
| InChIKey | QMGXXQNZELNSOQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|