C14H12Cl2N2O5S2 — CID 10137087
ethyl 2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetate (PubChem CID 10137087) has the molecular formula C14H12Cl2N2O5S2 and a molecular weight of 423.30 g/mol. Its IUPAC name is ethyl 2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 10137087 |
| Molecular Formula | C14H12Cl2N2O5S2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | ethyl 2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1csc(NS(=O)(=O)c2c(C)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H12Cl2N2O5S2/c1-3-23-13(20)11(19)10-6-24-14(17-10)18-25(21,22)12-7(2)4-8(15)5-9(12)16/h4-6H,3H2,1-2H3,(H,17,18) |
| InChIKey | CQCXDXXEKHBZCA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|