C12H8Cl2N2O5S2 — CID 87546058
2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid (PubChem CID 87546058) has the molecular formula C12H8Cl2N2O5S2 and a molecular weight of 395.25 g/mol. Its IUPAC name is 2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 87546058 |
| Molecular Formula | C12H8Cl2N2O5S2 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 2-[2-[(2,4-dichloro-6-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid |
| SMILES | Cc1cc(Cl)cc(Cl)c1S(=O)(=O)Nc1nc(C(=O)C(=O)O)cs1 |
| InChI | InChI=1S/C12H8Cl2N2O5S2/c1-5-2-6(13)3-7(14)10(5)23(20,21)16-12-15-8(4-22-12)9(17)11(18)19/h2-4H,1H3,(H,15,16)(H,18,19) |
| InChIKey | XMKIRXLTVZMSLH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|