C16H10Cl3FN2O2S2 — CID 10138882
2,4-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]-6-methylbenzenesulfonamide (PubChem CID 10138882) has the molecular formula C16H10Cl3FN2O2S2 and a molecular weight of 451.76 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]-6-methylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]-6-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10138882 |
| Molecular Formula | C16H10Cl3FN2O2S2 |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 449.92 |
| IUPAC Name | 2,4-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]-6-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)cc(Cl)c1S(=O)(=O)Nc1nc(-c2c(F)cccc2Cl)cs1 |
| InChI | InChI=1S/C16H10Cl3FN2O2S2/c1-8-5-9(17)6-11(19)15(8)26(23,24)22-16-21-13(7-25-16)14-10(18)3-2-4-12(14)20/h2-7H,1H3,(H,21,22) |
| InChIKey | VUQXWOCNCDSVII-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|