C13H6Cl3FN2O2S3 — CID 10114364
4,5-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide (PubChem CID 10114364) has the molecular formula C13H6Cl3FN2O2S3 and a molecular weight of 443.76 g/mol. Its IUPAC name is 4,5-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide.
| Compound Name | 4,5-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10114364 |
| Molecular Formula | C13H6Cl3FN2O2S3 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 441.86 |
| IUPAC Name | 4,5-dichloro-N-[4-(2-chloro-6-fluorophenyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2c(F)cccc2Cl)cs1)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C13H6Cl3FN2O2S3/c14-6-2-1-3-8(17)11(6)9-5-22-13(18-9)19-24(20,21)10-4-7(15)12(16)23-10/h1-5H,(H,18,19) |
| InChIKey | LXXRUQRDBHMNOA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|