C14H12ClN3O4S2 — CID 23047576
ethyl 2-[2-[(3-chlorophenyl)sulfanylcarbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate (PubChem CID 23047576) has the molecular formula C14H12ClN3O4S2 and a molecular weight of 385.85 g/mol. Its IUPAC name is ethyl 2-[2-[(3-chlorophenyl)sulfanylcarbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-[(3-chlorophenyl)sulfanylcarbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 23047576 |
| Molecular Formula | C14H12ClN3O4S2 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | ethyl 2-[2-[(3-chlorophenyl)sulfanylcarbamoylamino]-1,3-thiazol-4-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1csc(NC(=O)NSc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H12ClN3O4S2/c1-2-22-12(20)11(19)10-7-23-14(16-10)17-13(21)18-24-9-5-3-4-8(15)6-9/h3-7H,2H2,1H3,(H2,16,17,18,21) |
| InChIKey | RSUMYDPFWCGQHO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|