C20H24ClN5O4S — CID 141174565
ethyl (2Z)-2-[2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetate (PubChem CID 141174565) has the molecular formula C20H24ClN5O4S and a molecular weight of 465.96 g/mol. Its IUPAC name is ethyl (2Z)-2-[2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetate.
| Compound Name | ethyl (2Z)-2-[2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 141174565 |
| Molecular Formula | C20H24ClN5O4S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | ethyl (2Z)-2-[2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetate |
| SMILES | CCOC(=O)/C(=N\OC)c1csc(NC(=O)CN2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C20H24ClN5O4S/c1-3-30-19(28)18(24-29-2)16-13-31-20(22-16)23-17(27)12-25-7-9-26(10-8-25)15-6-4-5-14(21)11-15/h4-6,11,13H,3,7-10,12H2,1-2H3,(H,22,23,27)/b24-18- |
| InChIKey | ICPBKLVBQOXKKL-MOHJPFBDSA-N |
| XLogP | 2.47 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|