C13H11ClN2O3S — CID 46604902
(3-chlorophenyl)methyl 2-acetamido-1,3-thiazole-4-carboxylate (PubChem CID 46604902) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-acetamido-1,3-thiazole-4-carboxylate.
| Compound Name | (3-chlorophenyl)methyl 2-acetamido-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 46604902 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (3-chlorophenyl)methyl 2-acetamido-1,3-thiazole-4-carboxylate |
| SMILES | CC(=O)Nc1nc(C(=O)OCc2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C13H11ClN2O3S/c1-8(17)15-13-16-11(7-20-13)12(18)19-6-9-3-2-4-10(14)5-9/h2-5,7H,6H2,1H3,(H,15,16,17) |
| InChIKey | WJVLELWQRYCZGQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |