C12H18N2O4S2 — CID 138674013
ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]butanoate (PubChem CID 138674013) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]butanoate.
| Compound Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]butanoate |
|---|---|
| PubChem CID | 138674013 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]butanoate |
| SMILES | CCOC(=O)C(CC)c1csc(NS(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-3-9(11(15)18-4-2)10-7-19-12(13-10)14-20(16,17)8-5-6-8/h7-9H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | SEOKCRHMRSJMBD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |