C10H14N2O3S2 — CID 138701111
2-[2-(cyclopropylsulfinylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 138701111) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfinylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 2-[2-(cyclopropylsulfinylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 138701111 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-[2-(cyclopropylsulfinylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1csc(NS(=O)C2CC2)n1 |
| InChI | InChI=1S/C10H14N2O3S2/c1-2-7(9(13)14)8-5-16-10(11-8)12-17(15)6-3-4-6/h5-7H,2-4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | AASXQOUMOCICAA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |