C11H15N3O5S2 — CID 155760128
ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetate (PubChem CID 155760128) has the molecular formula C11H15N3O5S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetate.
| Compound Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 155760128 |
| Molecular Formula | C11H15N3O5S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetate |
| SMILES | CCOC(=O)C(=NOC)c1csc(NS(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C11H15N3O5S2/c1-3-19-10(15)9(13-18-2)8-6-20-11(12-8)14-21(16,17)7-4-5-7/h6-7H,3-5H2,1-2H3,(H,12,14) |
| InChIKey | VPMAUUCUURLDTO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|