C15H18N4O2S — CID 16948151
N-butan-2-yl-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide (PubChem CID 16948151) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-butan-2-yl-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-butan-2-yl-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16948151 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-butan-2-yl-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)NC(=O)c1csc(NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H18N4O2S/c1-3-10(2)16-13(20)12-9-22-15(18-12)19-14(21)17-11-7-5-4-6-8-11/h4-10H,3H2,1-2H3,(H,16,20)(H2,17,18,19,21) |
| InChIKey | UFUIGLCEPOAMGH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |