C15H15Cl2N3O2S — CID 46113759
N-butan-2-yl-2-[(3,4-dichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 46113759) has the molecular formula C15H15Cl2N3O2S and a molecular weight of 372.28 g/mol. Its IUPAC name is N-butan-2-yl-2-[(3,4-dichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butan-2-yl-2-[(3,4-dichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46113759 |
| Molecular Formula | C15H15Cl2N3O2S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-butan-2-yl-2-[(3,4-dichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)NC(=O)c1csc(NC(=O)c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H15Cl2N3O2S/c1-3-8(2)18-14(22)12-7-23-15(19-12)20-13(21)9-4-5-10(16)11(17)6-9/h4-8H,3H2,1-2H3,(H,18,22)(H,19,20,21) |
| InChIKey | UKYRWHPEMBAYNF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |